C11H21NO2 — CID 7648348
(3aR,4R,5S,6S,7aS)-6-(dimethylamino)-4-methyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran-5-ol (PubChem CID 7648348) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is (3aR,4R,5S,6S,7aS)-6-(dimethylamino)-4-methyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran-5-ol.
| Compound Name | (3aR,4R,5S,6S,7aS)-6-(dimethylamino)-4-methyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran-5-ol |
|---|---|
| PubChem CID | 7648348 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | (3aR,4R,5S,6S,7aS)-6-(dimethylamino)-4-methyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran-5-ol |
| SMILES | C[C@H]1[C@H](O)[C@@H](N(C)C)C[C@@H]2COC[C@H]21 |
| InChI | InChI=1S/C11H21NO2/c1-7-9-6-14-5-8(9)4-10(11(7)13)12(2)3/h7-11,13H,4-6H2,1-3H3/t7-,8-,9+,10+,11+/m1/s1 |
| InChIKey | GIVAORVDGOGQSN-UVOCVTCTSA-N |
| XLogP | 0.58 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |