C17H24N6O3S — CID 7648978
2-[[4-(3-ethoxypropyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(ethylcarbamoyl)acetamide (PubChem CID 7648978) has the molecular formula C17H24N6O3S and a molecular weight of 392.49 g/mol. Its IUPAC name is 2-[[4-(3-ethoxypropyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(ethylcarbamoyl)acetamide.
| Compound Name | 2-[[4-(3-ethoxypropyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(ethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 7648978 |
| Molecular Formula | C17H24N6O3S |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 2-[[4-(3-ethoxypropyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(ethylcarbamoyl)acetamide |
| SMILES | CCNC(=O)NC(=O)CSc1nnc(-c2ccncc2)n1CCCOCC |
| InChI | InChI=1S/C17H24N6O3S/c1-3-19-16(25)20-14(24)12-27-17-22-21-15(13-6-8-18-9-7-13)23(17)10-5-11-26-4-2/h6-9H,3-5,10-12H2,1-2H3,(H2,19,20,24,25) |
| InChIKey | HEYXNOOWANADOR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|