C8H8N2O2 — CID 764959
3,4-dihydro-2H-pyrido[1,2-a]pyrazine-1,8-dione (PubChem CID 764959) has the molecular formula C8H8N2O2 and a molecular weight of 164.16 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyrido[1,2-a]pyrazine-1,8-dione.
| Compound Name | 3,4-dihydro-2H-pyrido[1,2-a]pyrazine-1,8-dione |
|---|---|
| PubChem CID | 764959 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 3,4-dihydro-2H-pyrido[1,2-a]pyrazine-1,8-dione |
| SMILES | O=C1NCCn2ccc(=O)cc21 |
| InChI | InChI=1S/C8H8N2O2/c11-6-1-3-10-4-2-9-8(12)7(10)5-6/h1,3,5H,2,4H2,(H,9,12) |
| InChIKey | BORDYCDCNXARSZ-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |