About 8-hydroxynon-1-en-4-yl prop-2-enoate
8-hydroxynon-1-en-4-yl prop-2-enoate (PubChem CID 76511519) has the molecular formula C12H20O3
and a molecular weight of 212.29 g/mol. Its IUPAC name is 8-hydroxynon-1-en-4-yl prop-2-enoate.
Molecular Properties
| Compound Name | 8-hydroxynon-1-en-4-yl prop-2-enoate |
| PubChem CID | 76511519 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 8-hydroxynon-1-en-4-yl prop-2-enoate |
| SMILES | C=CCC(CCCC(C)O)OC(=O)C=C |
| InChI | InChI=1S/C12H20O3/c1-4-7-11(15-12(14)5-2)9-6-8-10(3)13/h4-5,10-11,13H,1-2,6-9H2,3H3 |
| InChIKey | AZJUTDBUIDKQGS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 8-hydroxynon-1-en-4-yl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hydroxynon-1-en-4-yl prop-2-enoate?
The IUPAC name of 8-hydroxynon-1-en-4-yl prop-2-enoate (CID 76511519) is 8-hydroxynon-1-en-4-yl prop-2-enoate.
What is the SMILES notation for 8-hydroxynon-1-en-4-yl prop-2-enoate?
The canonical SMILES for 8-hydroxynon-1-en-4-yl prop-2-enoate is C=CCC(CCCC(C)O)OC(=O)C=C.
What is the InChIKey of 8-hydroxynon-1-en-4-yl prop-2-enoate?
The InChIKey is AZJUTDBUIDKQGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3/c1-4-7-11(15-12(14)5-2)9-6-8-10(3)13/h4-5,10-11,13H,1-2,6-9H2,3H3.
What are the key properties of 8-hydroxynon-1-en-4-yl prop-2-enoate?
8-hydroxynon-1-en-4-yl prop-2-enoate has a molecular weight of 212.29 g/mol, XLogP of 2.21, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroxynon-1-en-4-yl prop-2-enoate is sourced from PubChem (CID 76511519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).