C16H23BN2O6 — CID 76513199
3-amino-4-(3-boronopropyl)-1-(4-methoxybenzoyl)pyrrolidine-3-carboxylic acid (PubChem CID 76513199) has the molecular formula C16H23BN2O6 and a molecular weight of 350.18 g/mol. Its IUPAC name is 3-amino-4-(3-boronopropyl)-1-(4-methoxybenzoyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 3-amino-4-(3-boronopropyl)-1-(4-methoxybenzoyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 76513199 |
| Molecular Formula | C16H23BN2O6 |
| Molecular Weight | 350.18 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 3-amino-4-(3-boronopropyl)-1-(4-methoxybenzoyl)pyrrolidine-3-carboxylic acid |
| SMILES | COc1ccc(C(=O)N2CC(CCCB(O)O)C(N)(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C16H23BN2O6/c1-25-13-6-4-11(5-7-13)14(20)19-9-12(3-2-8-17(23)24)16(18,10-19)15(21)22/h4-7,12,23-24H,2-3,8-10,18H2,1H3,(H,21,22) |
| InChIKey | FSSDQCFXMYSKNV-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.18 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|