About 3-(dimethylamino)propyl dec-2-enoate
3-(dimethylamino)propyl dec-2-enoate (PubChem CID 76513243) has the molecular formula C15H29NO2
and a molecular weight of 255.40 g/mol. Its IUPAC name is 3-(dimethylamino)propyl dec-2-enoate.
Molecular Properties
| Compound Name | 3-(dimethylamino)propyl dec-2-enoate |
| PubChem CID | 76513243 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | 3-(dimethylamino)propyl dec-2-enoate |
| SMILES | CCCCCCCC=CC(=O)OCCCN(C)C |
| InChI | InChI=1S/C15H29NO2/c1-4-5-6-7-8-9-10-12-15(17)18-14-11-13-16(2)3/h10,12H,4-9,11,13-14H2,1-3H3 |
| InChIKey | QADDIYJHBVALHF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethylamino)propyl dec-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)propyl dec-2-enoate?
The IUPAC name of 3-(dimethylamino)propyl dec-2-enoate (CID 76513243) is 3-(dimethylamino)propyl dec-2-enoate.
What is the SMILES notation for 3-(dimethylamino)propyl dec-2-enoate?
The canonical SMILES for 3-(dimethylamino)propyl dec-2-enoate is CCCCCCCC=CC(=O)OCCCN(C)C.
What is the InChIKey of 3-(dimethylamino)propyl dec-2-enoate?
The InChIKey is QADDIYJHBVALHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29NO2/c1-4-5-6-7-8-9-10-12-15(17)18-14-11-13-16(2)3/h10,12H,4-9,11,13-14H2,1-3H3.
What are the key properties of 3-(dimethylamino)propyl dec-2-enoate?
3-(dimethylamino)propyl dec-2-enoate has a molecular weight of 255.40 g/mol, XLogP of 3.40, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)propyl dec-2-enoate is sourced from PubChem (CID 76513243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).