About 2-[2-(2-fluorophenyl)ethenyl]-3,5,6-trimethylpyrazine
2-[2-(2-fluorophenyl)ethenyl]-3,5,6-trimethylpyrazine (PubChem CID 76514238) has the molecular formula C15H15FN2
and a molecular weight of 242.30 g/mol. Its IUPAC name is 2-[2-(2-fluorophenyl)ethenyl]-3,5,6-trimethylpyrazine.
Molecular Properties
| Compound Name | 2-[2-(2-fluorophenyl)ethenyl]-3,5,6-trimethylpyrazine |
| PubChem CID | 76514238 |
| Molecular Formula | C15H15FN2 |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-[2-(2-fluorophenyl)ethenyl]-3,5,6-trimethylpyrazine |
| SMILES | Cc1nc(C)c(C=Cc2ccccc2F)nc1C |
| InChI | InChI=1S/C15H15FN2/c1-10-11(2)18-15(12(3)17-10)9-8-13-6-4-5-7-14(13)16/h4-9H,1-3H3 |
| InChIKey | LKQZNXWHJMAQFB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[2-(2-fluorophenyl)ethenyl]-3,5,6-trimethylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-fluorophenyl)ethenyl]-3,5,6-trimethylpyrazine?
The IUPAC name of 2-[2-(2-fluorophenyl)ethenyl]-3,5,6-trimethylpyrazine (CID 76514238) is 2-[2-(2-fluorophenyl)ethenyl]-3,5,6-trimethylpyrazine.
What is the SMILES notation for 2-[2-(2-fluorophenyl)ethenyl]-3,5,6-trimethylpyrazine?
The canonical SMILES for 2-[2-(2-fluorophenyl)ethenyl]-3,5,6-trimethylpyrazine is Cc1nc(C)c(C=Cc2ccccc2F)nc1C.
What is the InChIKey of 2-[2-(2-fluorophenyl)ethenyl]-3,5,6-trimethylpyrazine?
The InChIKey is LKQZNXWHJMAQFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15FN2/c1-10-11(2)18-15(12(3)17-10)9-8-13-6-4-5-7-14(13)16/h4-9H,1-3H3.
What are the key properties of 2-[2-(2-fluorophenyl)ethenyl]-3,5,6-trimethylpyrazine?
2-[2-(2-fluorophenyl)ethenyl]-3,5,6-trimethylpyrazine has a molecular weight of 242.30 g/mol, XLogP of 3.71, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-fluorophenyl)ethenyl]-3,5,6-trimethylpyrazine is sourced from PubChem (CID 76514238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).