C36H32N8O2 — CID 76516571
3-[4-(dimethylamino)but-2-enoylamino]-N-[4-[[4-(2-phenylpyrazolo[1,5-a]pyridin-3-yl)pyrimidin-2-yl]amino]phenyl]benzamide (PubChem CID 76516571) has the molecular formula C36H32N8O2 and a molecular weight of 608.71 g/mol. Its IUPAC name is 3-[4-(dimethylamino)but-2-enoylamino]-N-[4-[[4-(2-phenylpyrazolo[1,5-a]pyridin-3-yl)pyrimidin-2-yl]amino]phenyl]benzamide.
| Compound Name | 3-[4-(dimethylamino)but-2-enoylamino]-N-[4-[[4-(2-phenylpyrazolo[1,5-a]pyridin-3-yl)pyrimidin-2-yl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 76516571 |
| Molecular Formula | C36H32N8O2 |
| Molecular Weight | 608.71 g/mol |
| Exact Mass | 608.26 |
| IUPAC Name | 3-[4-(dimethylamino)but-2-enoylamino]-N-[4-[[4-(2-phenylpyrazolo[1,5-a]pyridin-3-yl)pyrimidin-2-yl]amino]phenyl]benzamide |
| SMILES | CN(C)CC=CC(=O)Nc1cccc(C(=O)Nc2ccc(Nc3nccc(-c4c(-c5ccccc5)nn5ccccc45)n3)cc2)c1 |
| InChI | InChI=1S/C36H32N8O2/c1-43(2)22-9-15-32(45)38-29-13-8-12-26(24-29)35(46)39-27-16-18-28(19-17-27)40-36-37-21-20-30(41-36)33-31-14-6-7-23-44(31)42-34(33)25-10-4-3-5-11-25/h3-21,23-24H,22H2,1-2H3,(H,38,45)(H,39,46)(H,37,40,41) |
| InChIKey | OCZDPFMSAKKNRH-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 116.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.71 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|