C21H19ClN4O2 — CID 76518155
2-[9-(4-chlorophenyl)-3-methyl-5-oxa-4,8,13-triazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,8,11,13-hexaen-7-yl]-N-ethylacetamide (PubChem CID 76518155) has the molecular formula C21H19ClN4O2 and a molecular weight of 394.86 g/mol. Its IUPAC name is 2-[9-(4-chlorophenyl)-3-methyl-5-oxa-4,8,13-triazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,8,11,13-hexaen-7-yl]-N-ethylacetamide.
| Compound Name | 2-[9-(4-chlorophenyl)-3-methyl-5-oxa-4,8,13-triazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,8,11,13-hexaen-7-yl]-N-ethylacetamide |
|---|---|
| PubChem CID | 76518155 |
| Molecular Formula | C21H19ClN4O2 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 2-[9-(4-chlorophenyl)-3-methyl-5-oxa-4,8,13-triazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,8,11,13-hexaen-7-yl]-N-ethylacetamide |
| SMILES | CCNC(=O)CC1N=C(c2ccc(Cl)cc2)c2ccncc2-c2c(C)noc21 |
| InChI | InChI=1S/C21H19ClN4O2/c1-3-24-18(27)10-17-21-19(12(2)26-28-21)16-11-23-9-8-15(16)20(25-17)13-4-6-14(22)7-5-13/h4-9,11,17H,3,10H2,1-2H3,(H,24,27) |
| InChIKey | NQZXOTXCRFBZMD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 80.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |