C24H28N2O4 — CID 7652110
[2-(2,4-dimethylphenyl)-2-oxoethyl] (E)-2-cyano-3-[1-[(2R)-1-methoxypropan-2-yl]-2,5-dimethylpyrrol-3-yl]prop-2-enoate (PubChem CID 7652110) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is [2-(2,4-dimethylphenyl)-2-oxoethyl] (E)-2-cyano-3-[1-[(2R)-1-methoxypropan-2-yl]-2,5-dimethylpyrrol-3-yl]prop-2-enoate.
| Compound Name | [2-(2,4-dimethylphenyl)-2-oxoethyl] (E)-2-cyano-3-[1-[(2R)-1-methoxypropan-2-yl]-2,5-dimethylpyrrol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 7652110 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | [2-(2,4-dimethylphenyl)-2-oxoethyl] (E)-2-cyano-3-[1-[(2R)-1-methoxypropan-2-yl]-2,5-dimethylpyrrol-3-yl]prop-2-enoate |
| SMILES | COC[C@@H](C)n1c(C)cc(/C=C(\C#N)C(=O)OCC(=O)c2ccc(C)cc2C)c1C |
| InChI | InChI=1S/C24H28N2O4/c1-15-7-8-22(16(2)9-15)23(27)14-30-24(28)21(12-25)11-20-10-17(3)26(19(20)5)18(4)13-29-6/h7-11,18H,13-14H2,1-6H3/b21-11+/t18-/m1/s1 |
| InChIKey | JDGPHCKXPYVKGX-PGNNWUFWSA-N |
| XLogP | 4.26 |
| TPSA | 81.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|