About 4-[4-(1,3-dioxoisoindol-2-yl)phenoxy]benzonitrile
4-[4-(1,3-dioxoisoindol-2-yl)phenoxy]benzonitrile (PubChem CID 765217) has the molecular formula C21H12N2O3
and a molecular weight of 340.34 g/mol. Its IUPAC name is 4-[4-(1,3-dioxoisoindol-2-yl)phenoxy]benzonitrile.
Molecular Properties
| Compound Name | 4-[4-(1,3-dioxoisoindol-2-yl)phenoxy]benzonitrile |
| PubChem CID | 765217 |
| Molecular Formula | C21H12N2O3 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 4-[4-(1,3-dioxoisoindol-2-yl)phenoxy]benzonitrile |
| SMILES | N#Cc1ccc(Oc2ccc(N3C(=O)c4ccccc4C3=O)cc2)cc1 |
| InChI | InChI=1S/C21H12N2O3/c22-13-14-5-9-16(10-6-14)26-17-11-7-15(8-12-17)23-20(24)18-3-1-2-4-19(18)21(23)25/h1-12H |
| InChIKey | COAHRMZELKULHM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(1,3-dioxoisoindol-2-yl)phenoxy]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(1,3-dioxoisoindol-2-yl)phenoxy]benzonitrile?
The IUPAC name of 4-[4-(1,3-dioxoisoindol-2-yl)phenoxy]benzonitrile (CID 765217) is 4-[4-(1,3-dioxoisoindol-2-yl)phenoxy]benzonitrile.
What is the SMILES notation for 4-[4-(1,3-dioxoisoindol-2-yl)phenoxy]benzonitrile?
The canonical SMILES for 4-[4-(1,3-dioxoisoindol-2-yl)phenoxy]benzonitrile is N#Cc1ccc(Oc2ccc(N3C(=O)c4ccccc4C3=O)cc2)cc1.
What is the InChIKey of 4-[4-(1,3-dioxoisoindol-2-yl)phenoxy]benzonitrile?
The InChIKey is COAHRMZELKULHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H12N2O3/c22-13-14-5-9-16(10-6-14)26-17-11-7-15(8-12-17)23-20(24)18-3-1-2-4-19(18)21(23)25/h1-12H.
What are the key properties of 4-[4-(1,3-dioxoisoindol-2-yl)phenoxy]benzonitrile?
4-[4-(1,3-dioxoisoindol-2-yl)phenoxy]benzonitrile has a molecular weight of 340.34 g/mol, XLogP of 4.15, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(1,3-dioxoisoindol-2-yl)phenoxy]benzonitrile is sourced from PubChem (CID 765217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).