About 1-Chloro-3-fluoro-5-methanidyl-benzene;chlorozinc(1+)
1-Chloro-3-fluoro-5-methanidyl-benzene;chlorozinc(1+) (PubChem CID 76522389) has the molecular formula C7H5Cl2FZn
and a molecular weight of 244.41 g/mol.
Molecular Properties
| Compound Name | 1-Chloro-3-fluoro-5-methanidyl-benzene;chlorozinc(1+) |
| PubChem CID | 76522389 |
| Molecular Formula | C7H5Cl2FZn |
| Molecular Weight | 244.41 g/mol |
| Exact Mass | 241.90 |
| IUPAC Name | — |
| SMILES | [CH2-]c1cc(F)cc(Cl)c1.[Cl-].[Zn+2] |
| InChI | InChI=1S/C7H5ClF.ClH.Zn/c1-5-2-6(8)4-7(9)3-5;;/h2-4H,1H2;1H;/q-1;;+2/p-1 |
| InChIKey | UKTWCFURFGPWJS-UHFFFAOYSA-M |
| XLogP | -0.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.41 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-Chloro-3-fluoro-5-methanidyl-benzene;chlorozinc(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-Chloro-3-fluoro-5-methanidyl-benzene;chlorozinc(1+)?
The IUPAC name of 1-Chloro-3-fluoro-5-methanidyl-benzene;chlorozinc(1+) (CID 76522389) is not available.
What is the SMILES notation for 1-Chloro-3-fluoro-5-methanidyl-benzene;chlorozinc(1+)?
The canonical SMILES for 1-Chloro-3-fluoro-5-methanidyl-benzene;chlorozinc(1+) is [CH2-]c1cc(F)cc(Cl)c1.[Cl-].[Zn+2].
What is the InChIKey of 1-Chloro-3-fluoro-5-methanidyl-benzene;chlorozinc(1+)?
The InChIKey is UKTWCFURFGPWJS-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H5ClF.ClH.Zn/c1-5-2-6(8)4-7(9)3-5;;/h2-4H,1H2;1H;/q-1;;+2/p-1.
What are the key properties of 1-Chloro-3-fluoro-5-methanidyl-benzene;chlorozinc(1+)?
1-Chloro-3-fluoro-5-methanidyl-benzene;chlorozinc(1+) has a molecular weight of 244.41 g/mol, XLogP of -0.34, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-Chloro-3-fluoro-5-methanidyl-benzene;chlorozinc(1+) is sourced from PubChem (CID 76522389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).