ethyl 1-[(4-phenylphenyl)methyl]piperidine-4-carboxylate

C21H25NO2 — CID 765234

IUPACethyl 1-[(4-phenylphenyl)methyl]piperidine-4-carboxylate
SMILESCCOC(=O)C1CCN(Cc2ccc(-c3ccccc3)cc2)CC1
InChIInChI=1S/C21H25NO2/c1-2-24-21(23)20-12-14-22(15-13-20)16-17-8-10-19(11-9-17)18-6-4-3-5-7-18/h3-11,20H,2,12-16H2,1H3
InChIKeyUFFVOQWYVIDLKP-UHFFFAOYSA-N
MW323.44 g/mol
LogP4.13
Rot. Bonds5

About ethyl 1-[(4-phenylphenyl)methyl]piperidine-4-carboxylate

ethyl 1-[(4-phenylphenyl)methyl]piperidine-4-carboxylate (PubChem CID 765234) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is ethyl 1-[(4-phenylphenyl)methyl]piperidine-4-carboxylate.

Molecular Properties

Compound Nameethyl 1-[(4-phenylphenyl)methyl]piperidine-4-carboxylate
PubChem CID765234
Molecular FormulaC21H25NO2
Molecular Weight323.44 g/mol
Exact Mass323.19
IUPAC Nameethyl 1-[(4-phenylphenyl)methyl]piperidine-4-carboxylate
SMILESCCOC(=O)C1CCN(Cc2ccc(-c3ccccc3)cc2)CC1
InChIInChI=1S/C21H25NO2/c1-2-24-21(23)20-12-14-22(15-13-20)16-17-8-10-19(11-9-17)18-6-4-3-5-7-18/h3-11,20H,2,12-16H2,1H3
InChIKeyUFFVOQWYVIDLKP-UHFFFAOYSA-N
XLogP4.13
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms24
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500323.44
LogP ≤ 54.13
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze ethyl 1-[(4-phenylphenyl)methyl]piperidine-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 1-[(4-phenylphenyl)methyl]piperidine-4-carboxylate?
The IUPAC name of ethyl 1-[(4-phenylphenyl)methyl]piperidine-4-carboxylate (CID 765234) is ethyl 1-[(4-phenylphenyl)methyl]piperidine-4-carboxylate.
What is the SMILES notation for ethyl 1-[(4-phenylphenyl)methyl]piperidine-4-carboxylate?
The canonical SMILES for ethyl 1-[(4-phenylphenyl)methyl]piperidine-4-carboxylate is CCOC(=O)C1CCN(Cc2ccc(-c3ccccc3)cc2)CC1.
What is the InChIKey of ethyl 1-[(4-phenylphenyl)methyl]piperidine-4-carboxylate?
The InChIKey is UFFVOQWYVIDLKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25NO2/c1-2-24-21(23)20-12-14-22(15-13-20)16-17-8-10-19(11-9-17)18-6-4-3-5-7-18/h3-11,20H,2,12-16H2,1H3.
What are the key properties of ethyl 1-[(4-phenylphenyl)methyl]piperidine-4-carboxylate?
ethyl 1-[(4-phenylphenyl)methyl]piperidine-4-carboxylate has a molecular weight of 323.44 g/mol, XLogP of 4.13, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[(4-phenylphenyl)methyl]piperidine-4-carboxylate is sourced from PubChem (CID 765234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).