C41H55N5O3 — CID 76524257
N-benzhydryl-7-[2-[(4-tert-butylphenyl)methylamino]ethyl]-6-[2-(methylamino)butanoylamino]-5-oxo-1,2,3,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepine-3-carboxamide (PubChem CID 76524257) has the molecular formula C41H55N5O3 and a molecular weight of 665.92 g/mol. Its IUPAC name is N-benzhydryl-7-[2-[(4-tert-butylphenyl)methylamino]ethyl]-6-[2-(methylamino)butanoylamino]-5-oxo-1,2,3,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepine-3-carboxamide.
| Compound Name | N-benzhydryl-7-[2-[(4-tert-butylphenyl)methylamino]ethyl]-6-[2-(methylamino)butanoylamino]-5-oxo-1,2,3,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepine-3-carboxamide |
|---|---|
| PubChem CID | 76524257 |
| Molecular Formula | C41H55N5O3 |
| Molecular Weight | 665.92 g/mol |
| Exact Mass | 665.43 |
| IUPAC Name | N-benzhydryl-7-[2-[(4-tert-butylphenyl)methylamino]ethyl]-6-[2-(methylamino)butanoylamino]-5-oxo-1,2,3,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepine-3-carboxamide |
| SMILES | CCC(NC)C(=O)NC1C(=O)N2C(CCC1CCNCc1ccc(C(C)(C)C)cc1)CCC2C(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H55N5O3/c1-6-34(42-5)38(47)45-37-31(25-26-43-27-28-17-20-32(21-18-28)41(2,3)4)19-22-33-23-24-35(46(33)40(37)49)39(48)44-36(29-13-9-7-10-14-29)30-15-11-8-12-16-30/h7-18,20-21,31,33-37,42-43H,6,19,22-27H2,1-5H3,(H,44,48)(H,45,47) |
| InChIKey | SPJOCSPTXXQQQQ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 102.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.92 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|