C27H35FN4O2 — CID 76524576
N-[3-[(2-fluorophenyl)methyl]-3-hydroxycyclohexyl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide (PubChem CID 76524576) has the molecular formula C27H35FN4O2 and a molecular weight of 466.60 g/mol. Its IUPAC name is N-[3-[(2-fluorophenyl)methyl]-3-hydroxycyclohexyl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide.
| Compound Name | N-[3-[(2-fluorophenyl)methyl]-3-hydroxycyclohexyl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 76524576 |
| Molecular Formula | C27H35FN4O2 |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | N-[3-[(2-fluorophenyl)methyl]-3-hydroxycyclohexyl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
| SMILES | Cc1cc(C2NNC3CCC(C(=O)NC4CCCC(O)(Cc5ccccc5F)C4)CC32)ccn1 |
| InChI | InChI=1S/C27H35FN4O2/c1-17-13-18(10-12-29-17)25-22-14-19(8-9-24(22)31-32-25)26(33)30-21-6-4-11-27(34,16-21)15-20-5-2-3-7-23(20)28/h2-3,5,7,10,12-13,19,21-22,24-25,31-32,34H,4,6,8-9,11,14-16H2,1H3,(H,30,33) |
| InChIKey | UOBKTSYRQYOLNJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |