C14H20O4 — CID 76524602
8,8a-dihydroxy-4,7,7-trimethyl-3,4,5,5a,6,8-hexahydrocyclopenta[g][2]benzofuran-1-one (PubChem CID 76524602) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is 8,8a-dihydroxy-4,7,7-trimethyl-3,4,5,5a,6,8-hexahydrocyclopenta[g][2]benzofuran-1-one.
| Compound Name | 8,8a-dihydroxy-4,7,7-trimethyl-3,4,5,5a,6,8-hexahydrocyclopenta[g][2]benzofuran-1-one |
|---|---|
| PubChem CID | 76524602 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 8,8a-dihydroxy-4,7,7-trimethyl-3,4,5,5a,6,8-hexahydrocyclopenta[g][2]benzofuran-1-one |
| SMILES | CC1CC2CC(C)(C)C(O)C2(O)C2=C1COC2=O |
| InChI | InChI=1S/C14H20O4/c1-7-4-8-5-13(2,3)12(16)14(8,17)10-9(7)6-18-11(10)15/h7-8,12,16-17H,4-6H2,1-3H3 |
| InChIKey | BCUOGZVXZURDHS-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |