About 7-pyrrolidin-2-yltrideca-5,8-diyn-7-ol
7-pyrrolidin-2-yltrideca-5,8-diyn-7-ol (PubChem CID 76525940) has the molecular formula C17H27NO
and a molecular weight of 261.41 g/mol. Its IUPAC name is 7-pyrrolidin-2-yltrideca-5,8-diyn-7-ol.
Molecular Properties
| Compound Name | 7-pyrrolidin-2-yltrideca-5,8-diyn-7-ol |
| PubChem CID | 76525940 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 7-pyrrolidin-2-yltrideca-5,8-diyn-7-ol |
| SMILES | CCCCC#CC(O)(C#CCCCC)C1CCCN1 |
| InChI | InChI=1S/C17H27NO/c1-3-5-7-9-13-17(19,14-10-8-6-4-2)16-12-11-15-18-16/h16,18-19H,3-8,11-12,15H2,1-2H3 |
| InChIKey | CAVUREUXTCQHPD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-pyrrolidin-2-yltrideca-5,8-diyn-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-pyrrolidin-2-yltrideca-5,8-diyn-7-ol?
The IUPAC name of 7-pyrrolidin-2-yltrideca-5,8-diyn-7-ol (CID 76525940) is 7-pyrrolidin-2-yltrideca-5,8-diyn-7-ol.
What is the SMILES notation for 7-pyrrolidin-2-yltrideca-5,8-diyn-7-ol?
The canonical SMILES for 7-pyrrolidin-2-yltrideca-5,8-diyn-7-ol is CCCCC#CC(O)(C#CCCCC)C1CCCN1.
What is the InChIKey of 7-pyrrolidin-2-yltrideca-5,8-diyn-7-ol?
The InChIKey is CAVUREUXTCQHPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NO/c1-3-5-7-9-13-17(19,14-10-8-6-4-2)16-12-11-15-18-16/h16,18-19H,3-8,11-12,15H2,1-2H3.
What are the key properties of 7-pyrrolidin-2-yltrideca-5,8-diyn-7-ol?
7-pyrrolidin-2-yltrideca-5,8-diyn-7-ol has a molecular weight of 261.41 g/mol, XLogP of 2.86, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-pyrrolidin-2-yltrideca-5,8-diyn-7-ol is sourced from PubChem (CID 76525940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).