C35H43F2NO8 — CID 76526799
ethyl 2-amino-4,4-difluoro-4-[3-(methoxymethoxy)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butanoate (PubChem CID 76526799) has the molecular formula C35H43F2NO8 and a molecular weight of 643.72 g/mol. Its IUPAC name is ethyl 2-amino-4,4-difluoro-4-[3-(methoxymethoxy)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butanoate.
| Compound Name | ethyl 2-amino-4,4-difluoro-4-[3-(methoxymethoxy)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butanoate |
|---|---|
| PubChem CID | 76526799 |
| Molecular Formula | C35H43F2NO8 |
| Molecular Weight | 643.72 g/mol |
| Exact Mass | 643.30 |
| IUPAC Name | ethyl 2-amino-4,4-difluoro-4-[3-(methoxymethoxy)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butanoate |
| SMILES | CCOC(=O)C(N)CC(F)(F)C1OC(COCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)C1OCOC |
| InChI | InChI=1S/C35H43F2NO8/c1-3-42-34(39)28(38)19-35(36,37)33-32(45-24-40-2)31(44-22-27-17-11-6-12-18-27)30(43-21-26-15-9-5-10-16-26)29(46-33)23-41-20-25-13-7-4-8-14-25/h4-18,28-33H,3,19-24,38H2,1-2H3 |
| InChIKey | YBZWIIRRSSSUGT-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 107.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.72 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|