C28H37FN4O2 — CID 76526833
N-[3-[(2-fluorophenyl)methyl]-3-methoxycyclohexyl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide (PubChem CID 76526833) has the molecular formula C28H37FN4O2 and a molecular weight of 480.63 g/mol. Its IUPAC name is N-[3-[(2-fluorophenyl)methyl]-3-methoxycyclohexyl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide.
| Compound Name | N-[3-[(2-fluorophenyl)methyl]-3-methoxycyclohexyl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 76526833 |
| Molecular Formula | C28H37FN4O2 |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.29 |
| IUPAC Name | N-[3-[(2-fluorophenyl)methyl]-3-methoxycyclohexyl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
| SMILES | COC1(Cc2ccccc2F)CCCC(NC(=O)C2CCC3NNC(c4ccnc(C)c4)C3C2)C1 |
| InChI | InChI=1S/C28H37FN4O2/c1-18-14-19(11-13-30-18)26-23-15-20(9-10-25(23)32-33-26)27(34)31-22-7-5-12-28(17-22,35-2)16-21-6-3-4-8-24(21)29/h3-4,6,8,11,13-14,20,22-23,25-26,32-33H,5,7,9-10,12,15-17H2,1-2H3,(H,31,34) |
| InChIKey | WQERKKZNUUKSCH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |