C27H35FN4O3 — CID 76526876
N-[3-(3-fluorophenoxy)-3-(hydroxymethyl)cyclohexyl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide (PubChem CID 76526876) has the molecular formula C27H35FN4O3 and a molecular weight of 482.60 g/mol. Its IUPAC name is N-[3-(3-fluorophenoxy)-3-(hydroxymethyl)cyclohexyl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide.
| Compound Name | N-[3-(3-fluorophenoxy)-3-(hydroxymethyl)cyclohexyl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 76526876 |
| Molecular Formula | C27H35FN4O3 |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | N-[3-(3-fluorophenoxy)-3-(hydroxymethyl)cyclohexyl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
| SMILES | Cc1cc(C2NNC3CCC(C(=O)NC4CCCC(CO)(Oc5cccc(F)c5)C4)CC32)ccn1 |
| InChI | InChI=1S/C27H35FN4O3/c1-17-12-18(9-11-29-17)25-23-13-19(7-8-24(23)31-32-25)26(34)30-21-5-3-10-27(15-21,16-33)35-22-6-2-4-20(28)14-22/h2,4,6,9,11-12,14,19,21,23-25,31-33H,3,5,7-8,10,13,15-16H2,1H3,(H,30,34) |
| InChIKey | ICHPLEYIRIXDTC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 95.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |