C21H23N3O4 — CID 76527058
5-ethyl-3-[6-[(3,3,7-trimethyl-2H-1-benzofuran-4-yl)oxy]-3-pyridinyl]imidazolidine-2,4-dione (PubChem CID 76527058) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 5-ethyl-3-[6-[(3,3,7-trimethyl-2H-1-benzofuran-4-yl)oxy]-3-pyridinyl]imidazolidine-2,4-dione.
| Compound Name | 5-ethyl-3-[6-[(3,3,7-trimethyl-2H-1-benzofuran-4-yl)oxy]-3-pyridinyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 76527058 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 5-ethyl-3-[6-[(3,3,7-trimethyl-2H-1-benzofuran-4-yl)oxy]-3-pyridinyl]imidazolidine-2,4-dione |
| SMILES | CCC1NC(=O)N(c2ccc(Oc3ccc(C)c4c3C(C)(C)CO4)nc2)C1=O |
| InChI | InChI=1S/C21H23N3O4/c1-5-14-19(25)24(20(26)23-14)13-7-9-16(22-10-13)28-15-8-6-12(2)18-17(15)21(3,4)11-27-18/h6-10,14H,5,11H2,1-4H3,(H,23,26) |
| InChIKey | YHKIKNMCENTLLI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|