C34H33N3O2 — CID 76527206
N-benzyl-5,9,9-trimethyl-10-oxa-19,26-diazahexacyclo[16.8.0.02,11.03,8.012,17.020,25]hexacosa-1(26),2(11),12,14,16,18,20(25),21,23-nonaene-22-carboxamide (PubChem CID 76527206) has the molecular formula C34H33N3O2 and a molecular weight of 515.66 g/mol. Its IUPAC name is N-benzyl-5,9,9-trimethyl-10-oxa-19,26-diazahexacyclo[16.8.0.02,11.03,8.012,17.020,25]hexacosa-1(26),2(11),12,14,16,18,20(25),21,23-nonaene-22-carboxamide.
| Compound Name | N-benzyl-5,9,9-trimethyl-10-oxa-19,26-diazahexacyclo[16.8.0.02,11.03,8.012,17.020,25]hexacosa-1(26),2(11),12,14,16,18,20(25),21,23-nonaene-22-carboxamide |
|---|---|
| PubChem CID | 76527206 |
| Molecular Formula | C34H33N3O2 |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | N-benzyl-5,9,9-trimethyl-10-oxa-19,26-diazahexacyclo[16.8.0.02,11.03,8.012,17.020,25]hexacosa-1(26),2(11),12,14,16,18,20(25),21,23-nonaene-22-carboxamide |
| SMILES | CC1CCC2C(C1)c1c(c3ccccc3c3nc4cc(C(=O)NCc5ccccc5)ccc4nc13)OC2(C)C |
| InChI | InChI=1S/C34H33N3O2/c1-20-13-15-26-25(17-20)29-31-30(23-11-7-8-12-24(23)32(29)39-34(26,2)3)37-28-18-22(14-16-27(28)36-31)33(38)35-19-21-9-5-4-6-10-21/h4-12,14,16,18,20,25-26H,13,15,17,19H2,1-3H3,(H,35,38) |
| InChIKey | QZNCIPBUHISWHT-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|