C30H37N7O — CID 76527361
N-[3-(benzimidazol-1-ylmethyl)cyclohexyl]-3-(2-methylindazol-5-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide (PubChem CID 76527361) has the molecular formula C30H37N7O and a molecular weight of 511.67 g/mol. Its IUPAC name is N-[3-(benzimidazol-1-ylmethyl)cyclohexyl]-3-(2-methylindazol-5-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide.
| Compound Name | N-[3-(benzimidazol-1-ylmethyl)cyclohexyl]-3-(2-methylindazol-5-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 76527361 |
| Molecular Formula | C30H37N7O |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.31 |
| IUPAC Name | N-[3-(benzimidazol-1-ylmethyl)cyclohexyl]-3-(2-methylindazol-5-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
| SMILES | Cn1cc2cc(C3NNC4CCC(C(=O)NC5CCCC(Cn6cnc7ccccc76)C5)CC43)ccc2n1 |
| InChI | InChI=1S/C30H37N7O/c1-36-17-22-14-20(9-11-25(22)35-36)29-24-15-21(10-12-26(24)33-34-29)30(38)32-23-6-4-5-19(13-23)16-37-18-31-27-7-2-3-8-28(27)37/h2-3,7-9,11,14,17-19,21,23-24,26,29,33-34H,4-6,10,12-13,15-16H2,1H3,(H,32,38) |
| InChIKey | NYWRGQCLMUTAHW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 88.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |