C26H33FN4O2 — CID 76527399
N-[3-(2-fluorophenoxy)cyclohexyl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide (PubChem CID 76527399) has the molecular formula C26H33FN4O2 and a molecular weight of 452.57 g/mol. Its IUPAC name is N-[3-(2-fluorophenoxy)cyclohexyl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide.
| Compound Name | N-[3-(2-fluorophenoxy)cyclohexyl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 76527399 |
| Molecular Formula | C26H33FN4O2 |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | N-[3-(2-fluorophenoxy)cyclohexyl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
| SMILES | Cc1cc(C2NNC3CCC(C(=O)NC4CCCC(Oc5ccccc5F)C4)CC32)ccn1 |
| InChI | InChI=1S/C26H33FN4O2/c1-16-13-17(11-12-28-16)25-21-14-18(9-10-23(21)30-31-25)26(32)29-19-5-4-6-20(15-19)33-24-8-3-2-7-22(24)27/h2-3,7-8,11-13,18-21,23,25,30-31H,4-6,9-10,14-15H2,1H3,(H,29,32) |
| InChIKey | DRGGNNQVBAZKOW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |