C23H21ClO2 — CID 7652853
2-(2-chloro-4-phenylphenoxy)-1-(2,4,5-trimethylphenyl)ethanone (PubChem CID 7652853) has the molecular formula C23H21ClO2 and a molecular weight of 364.87 g/mol. Its IUPAC name is 2-(2-chloro-4-phenylphenoxy)-1-(2,4,5-trimethylphenyl)ethanone.
| Compound Name | 2-(2-chloro-4-phenylphenoxy)-1-(2,4,5-trimethylphenyl)ethanone |
|---|---|
| PubChem CID | 7652853 |
| Molecular Formula | C23H21ClO2 |
| Molecular Weight | 364.87 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 2-(2-chloro-4-phenylphenoxy)-1-(2,4,5-trimethylphenyl)ethanone |
| SMILES | Cc1cc(C)c(C(=O)COc2ccc(-c3ccccc3)cc2Cl)cc1C |
| InChI | InChI=1S/C23H21ClO2/c1-15-11-17(3)20(12-16(15)2)22(25)14-26-23-10-9-19(13-21(23)24)18-7-5-4-6-8-18/h4-13H,14H2,1-3H3 |
| InChIKey | DMDZGLAAUYLGHC-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.87 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |