About 4-phenylimidazole-1,2-diamine
4-phenylimidazole-1,2-diamine (PubChem CID 765290) has the molecular formula C9H10N4
and a molecular weight of 174.21 g/mol. Its IUPAC name is 4-phenylimidazole-1,2-diamine.
Molecular Properties
| Compound Name | 4-phenylimidazole-1,2-diamine |
| PubChem CID | 765290 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 4-phenylimidazole-1,2-diamine |
| SMILES | Nc1nc(-c2ccccc2)cn1N |
| InChI | InChI=1S/C9H10N4/c10-9-12-8(6-13(9)11)7-4-2-1-3-5-7/h1-6H,11H2,(H2,10,12) |
| InChIKey | PDRGDRQVKOPWFY-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-phenylimidazole-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylimidazole-1,2-diamine?
The IUPAC name of 4-phenylimidazole-1,2-diamine (CID 765290) is 4-phenylimidazole-1,2-diamine.
What is the SMILES notation for 4-phenylimidazole-1,2-diamine?
The canonical SMILES for 4-phenylimidazole-1,2-diamine is Nc1nc(-c2ccccc2)cn1N.
What is the InChIKey of 4-phenylimidazole-1,2-diamine?
The InChIKey is PDRGDRQVKOPWFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4/c10-9-12-8(6-13(9)11)7-4-2-1-3-5-7/h1-6H,11H2,(H2,10,12).
What are the key properties of 4-phenylimidazole-1,2-diamine?
4-phenylimidazole-1,2-diamine has a molecular weight of 174.21 g/mol, XLogP of 0.85, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylimidazole-1,2-diamine is sourced from PubChem (CID 765290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).