C13H16BF2NO2 — CID 76529203
3,5-difluoro-2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridine (PubChem CID 76529203) has the molecular formula C13H16BF2NO2 and a molecular weight of 267.08 g/mol. Its IUPAC name is 3,5-difluoro-2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridine.
| Compound Name | 3,5-difluoro-2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridine |
|---|---|
| PubChem CID | 76529203 |
| Molecular Formula | C13H16BF2NO2 |
| Molecular Weight | 267.08 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 3,5-difluoro-2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridine |
| SMILES | CC1(C)OB(C=Cc2ncc(F)cc2F)OC1(C)C |
| InChI | InChI=1S/C13H16BF2NO2/c1-12(2)13(3,4)19-14(18-12)6-5-11-10(16)7-9(15)8-17-11/h5-8H,1-4H3 |
| InChIKey | CHKMRHSPROYQNN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.08 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|