C23H26ClNO2 — CID 7653002
(2R)-2-(2-chloro-4-phenylphenoxy)-N-[2-(cyclohexen-1-yl)ethyl]propanamide (PubChem CID 7653002) has the molecular formula C23H26ClNO2 and a molecular weight of 383.92 g/mol. Its IUPAC name is (2R)-2-(2-chloro-4-phenylphenoxy)-N-[2-(cyclohexen-1-yl)ethyl]propanamide.
| Compound Name | (2R)-2-(2-chloro-4-phenylphenoxy)-N-[2-(cyclohexen-1-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 7653002 |
| Molecular Formula | C23H26ClNO2 |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | (2R)-2-(2-chloro-4-phenylphenoxy)-N-[2-(cyclohexen-1-yl)ethyl]propanamide |
| SMILES | C[C@@H](Oc1ccc(-c2ccccc2)cc1Cl)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C23H26ClNO2/c1-17(23(26)25-15-14-18-8-4-2-5-9-18)27-22-13-12-20(16-21(22)24)19-10-6-3-7-11-19/h3,6-8,10-13,16-17H,2,4-5,9,14-15H2,1H3,(H,25,26)/t17-/m1/s1 |
| InChIKey | NZGQVNAFHOWEFB-QGZVFWFLSA-N |
| XLogP | 5.78 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|