About zinc;4-methyl-2H-pyridin-2-ide;bromide
zinc;4-methyl-2H-pyridin-2-ide;bromide (PubChem CID 76530191) has the molecular formula C6H6BrNZn
and a molecular weight of 237.41 g/mol. Its IUPAC name is zinc;4-methyl-2H-pyridin-2-ide;bromide.
Molecular Properties
| Compound Name | zinc;4-methyl-2H-pyridin-2-ide;bromide |
| PubChem CID | 76530191 |
| Molecular Formula | C6H6BrNZn |
| Molecular Weight | 237.41 g/mol |
| Exact Mass | 234.90 |
| IUPAC Name | zinc;4-methyl-2H-pyridin-2-ide;bromide |
| SMILES | Cc1c[c-]ncc1.[Br-].[Zn+2] |
| InChI | InChI=1S/C6H6N.BrH.Zn/c1-6-2-4-7-5-3-6;;/h2-4H,1H3;1H;/q-1;;+2/p-1 |
| InChIKey | LSKVNRHSNXUCHS-UHFFFAOYSA-M |
| XLogP | -1.81 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.41 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;4-methyl-2H-pyridin-2-ide;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;4-methyl-2H-pyridin-2-ide;bromide?
The IUPAC name of zinc;4-methyl-2H-pyridin-2-ide;bromide (CID 76530191) is zinc;4-methyl-2H-pyridin-2-ide;bromide.
What is the SMILES notation for zinc;4-methyl-2H-pyridin-2-ide;bromide?
The canonical SMILES for zinc;4-methyl-2H-pyridin-2-ide;bromide is Cc1c[c-]ncc1.[Br-].[Zn+2].
What is the InChIKey of zinc;4-methyl-2H-pyridin-2-ide;bromide?
The InChIKey is LSKVNRHSNXUCHS-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H6N.BrH.Zn/c1-6-2-4-7-5-3-6;;/h2-4H,1H3;1H;/q-1;;+2/p-1.
What are the key properties of zinc;4-methyl-2H-pyridin-2-ide;bromide?
zinc;4-methyl-2H-pyridin-2-ide;bromide has a molecular weight of 237.41 g/mol, XLogP of -1.81, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;4-methyl-2H-pyridin-2-ide;bromide is sourced from PubChem (CID 76530191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).