C20H18Cl2F3N3O3 — CID 76530255
N-(2-cyclopropyl-2-methoxyiminoethyl)-5-(3,4-dichlorophenyl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide (PubChem CID 76530255) has the molecular formula C20H18Cl2F3N3O3 and a molecular weight of 476.28 g/mol. Its IUPAC name is N-(2-cyclopropyl-2-methoxyiminoethyl)-5-(3,4-dichlorophenyl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide.
| Compound Name | N-(2-cyclopropyl-2-methoxyiminoethyl)-5-(3,4-dichlorophenyl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 76530255 |
| Molecular Formula | C20H18Cl2F3N3O3 |
| Molecular Weight | 476.28 g/mol |
| Exact Mass | 475.07 |
| IUPAC Name | N-(2-cyclopropyl-2-methoxyiminoethyl)-5-(3,4-dichlorophenyl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
| SMILES | CON=C(CNC(=O)c1cnc(OCC(F)(F)F)c(-c2ccc(Cl)c(Cl)c2)c1)C1CC1 |
| InChI | InChI=1S/C20H18Cl2F3N3O3/c1-30-28-17(11-2-3-11)9-26-18(29)13-6-14(12-4-5-15(21)16(22)7-12)19(27-8-13)31-10-20(23,24)25/h4-8,11H,2-3,9-10H2,1H3,(H,26,29) |
| InChIKey | KXLPLCHRDZMRJI-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.28 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|