C21H24ClNO2 — CID 7653172
2-(2-chloro-4-phenylphenoxy)-N-(cyclohexylmethyl)acetamide (PubChem CID 7653172) has the molecular formula C21H24ClNO2 and a molecular weight of 357.88 g/mol. Its IUPAC name is 2-(2-chloro-4-phenylphenoxy)-N-(cyclohexylmethyl)acetamide.
| Compound Name | 2-(2-chloro-4-phenylphenoxy)-N-(cyclohexylmethyl)acetamide |
|---|---|
| PubChem CID | 7653172 |
| Molecular Formula | C21H24ClNO2 |
| Molecular Weight | 357.88 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 2-(2-chloro-4-phenylphenoxy)-N-(cyclohexylmethyl)acetamide |
| SMILES | O=C(COc1ccc(-c2ccccc2)cc1Cl)NCC1CCCCC1 |
| InChI | InChI=1S/C21H24ClNO2/c22-19-13-18(17-9-5-2-6-10-17)11-12-20(19)25-15-21(24)23-14-16-7-3-1-4-8-16/h2,5-6,9-13,16H,1,3-4,7-8,14-15H2,(H,23,24) |
| InChIKey | VSYJFYCPKAPGHX-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.88 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |