C20H36O2 — CID 76531752
3-hydroxy-4,6,8,10,12-pentamethylpentadeca-6,8-dien-5-one (PubChem CID 76531752) has the molecular formula C20H36O2 and a molecular weight of 308.51 g/mol. Its IUPAC name is 3-hydroxy-4,6,8,10,12-pentamethylpentadeca-6,8-dien-5-one.
| Compound Name | 3-hydroxy-4,6,8,10,12-pentamethylpentadeca-6,8-dien-5-one |
|---|---|
| PubChem CID | 76531752 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | 3-hydroxy-4,6,8,10,12-pentamethylpentadeca-6,8-dien-5-one |
| SMILES | CCCC(C)CC(C)C=C(C)C=C(C)C(=O)C(C)C(O)CC |
| InChI | InChI=1S/C20H36O2/c1-8-10-14(3)11-15(4)12-16(5)13-17(6)20(22)18(7)19(21)9-2/h12-15,18-19,21H,8-11H2,1-7H3 |
| InChIKey | JXDKPLUHXBSYLP-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|