C10H10F9I — CID 76533840
1,1,1,2,2,3,3,4,4-nonafluoro-6-iododec-5-ene (PubChem CID 76533840) has the molecular formula C10H10F9I and a molecular weight of 428.08 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4-nonafluoro-6-iododec-5-ene.
| Compound Name | 1,1,1,2,2,3,3,4,4-nonafluoro-6-iododec-5-ene |
|---|---|
| PubChem CID | 76533840 |
| Molecular Formula | C10H10F9I |
| Molecular Weight | 428.08 g/mol |
| Exact Mass | 427.97 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4-nonafluoro-6-iododec-5-ene |
| SMILES | CCCCC(I)=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H10F9I/c1-2-3-4-6(20)5-7(11,12)8(13,14)9(15,16)10(17,18)19/h5H,2-4H2,1H3 |
| InChIKey | FOSSNNCPAUONPQ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.08 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|