C41H35F3N8O — CID 76534137
N-[3-[[3,5-difluoro-6-(5-fluoro-1-tritylpyrazolo[5,4-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]-1-methylimidazole-4-carboxamide (PubChem CID 76534137) has the molecular formula C41H35F3N8O and a molecular weight of 712.78 g/mol. Its IUPAC name is N-[3-[[3,5-difluoro-6-(5-fluoro-1-tritylpyrazolo[5,4-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]-1-methylimidazole-4-carboxamide.
| Compound Name | N-[3-[[3,5-difluoro-6-(5-fluoro-1-tritylpyrazolo[5,4-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]-1-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 76534137 |
| Molecular Formula | C41H35F3N8O |
| Molecular Weight | 712.78 g/mol |
| Exact Mass | 712.29 |
| IUPAC Name | N-[3-[[3,5-difluoro-6-(5-fluoro-1-tritylpyrazolo[5,4-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]-1-methylimidazole-4-carboxamide |
| SMILES | Cn1cnc(C(=O)NC2CCCC(Nc3nc(-c4nn(C(c5ccccc5)(c5ccccc5)c5ccccc5)c5ncc(F)cc45)c(F)cc3F)C2)c1 |
| InChI | InChI=1S/C41H35F3N8O/c1-51-24-35(46-25-51)40(53)48-31-19-11-18-30(21-31)47-38-34(44)22-33(43)37(49-38)36-32-20-29(42)23-45-39(32)52(50-36)41(26-12-5-2-6-13-26,27-14-7-3-8-15-27)28-16-9-4-10-17-28/h2-10,12-17,20,22-25,30-31H,11,18-19,21H2,1H3,(H,47,49)(H,48,53) |
| InChIKey | PPRPTOZRULGRET-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 102.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.78 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|