C52H61N9O8 — CID 76534321
(4-tert-butylphenyl) 2,5-bis[2-[1-[2-(methoxycarbonylamino)-3-methylbutanoyl]pyrrolidin-2-yl]-3H-benzimidazol-5-yl]pyridine-4-carboxylate (PubChem CID 76534321) has the molecular formula C52H61N9O8 and a molecular weight of 940.11 g/mol. Its IUPAC name is (4-tert-butylphenyl) 2,5-bis[2-[1-[2-(methoxycarbonylamino)-3-methylbutanoyl]pyrrolidin-2-yl]-3H-benzimidazol-5-yl]pyridine-4-carboxylate.
| Compound Name | (4-tert-butylphenyl) 2,5-bis[2-[1-[2-(methoxycarbonylamino)-3-methylbutanoyl]pyrrolidin-2-yl]-3H-benzimidazol-5-yl]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 76534321 |
| Molecular Formula | C52H61N9O8 |
| Molecular Weight | 940.11 g/mol |
| Exact Mass | 939.46 |
| IUPAC Name | (4-tert-butylphenyl) 2,5-bis[2-[1-[2-(methoxycarbonylamino)-3-methylbutanoyl]pyrrolidin-2-yl]-3H-benzimidazol-5-yl]pyridine-4-carboxylate |
| SMILES | COC(=O)NC(C(=O)N1CCCC1c1nc2ccc(-c3cc(C(=O)Oc4ccc(C(C)(C)C)cc4)c(-c4ccc5nc(C6CCCN6C(=O)C(NC(=O)OC)C(C)C)[nH]c5c4)cn3)cc2[nH]1)C(C)C |
| InChI | InChI=1S/C52H61N9O8/c1-28(2)43(58-50(65)67-8)47(62)60-22-10-12-41(60)45-54-36-20-14-30(24-39(36)56-45)35-27-53-38(26-34(35)49(64)69-33-18-16-32(17-19-33)52(5,6)7)31-15-21-37-40(25-31)57-46(55-37)42-13-11-23-61(42)48(63)44(29(3)4)59-51(66)68-9/h14-21,24-29,41-44H,10-13,22-23H2,1-9H3,(H,54,56)(H,55,57)(H,58,65)(H,59,66) |
| InChIKey | XXWYCMUKXIFJMX-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 213.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 940.11 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|