C41H51NO6 — CID 76538188
[6-[3-(3-methoxy-3-oxopropyl)-11,15-dimethyl-5-methylidene-6-oxo-7-oxapentacyclo[8.7.0.01,3.04,8.011,15]heptadecan-14-yl]-2-methylhept-2-enyl] quinoline-2-carboxylate (PubChem CID 76538188) has the molecular formula C41H51NO6 and a molecular weight of 653.86 g/mol. Its IUPAC name is [6-[3-(3-methoxy-3-oxopropyl)-11,15-dimethyl-5-methylidene-6-oxo-7-oxapentacyclo[8.7.0.01,3.04,8.011,15]heptadecan-14-yl]-2-methylhept-2-enyl] quinoline-2-carboxylate.
| Compound Name | [6-[3-(3-methoxy-3-oxopropyl)-11,15-dimethyl-5-methylidene-6-oxo-7-oxapentacyclo[8.7.0.01,3.04,8.011,15]heptadecan-14-yl]-2-methylhept-2-enyl] quinoline-2-carboxylate |
|---|---|
| PubChem CID | 76538188 |
| Molecular Formula | C41H51NO6 |
| Molecular Weight | 653.86 g/mol |
| Exact Mass | 653.37 |
| IUPAC Name | [6-[3-(3-methoxy-3-oxopropyl)-11,15-dimethyl-5-methylidene-6-oxo-7-oxapentacyclo[8.7.0.01,3.04,8.011,15]heptadecan-14-yl]-2-methylhept-2-enyl] quinoline-2-carboxylate |
| SMILES | C=C1C(=O)OC2CC3C4(C)CCC(C(C)CCC=C(C)COC(=O)c5ccc6ccccc6n5)C4(C)CCC34CC4(CCC(=O)OC)C12 |
| InChI | InChI=1S/C41H51NO6/c1-25(23-47-37(45)31-15-14-28-12-7-8-13-30(28)42-31)10-9-11-26(2)29-16-18-39(5)33-22-32-35(27(3)36(44)48-32)41(19-17-34(43)46-6)24-40(33,41)21-20-38(29,39)4/h7-8,10,12-15,26,29,32-33,35H,3,9,11,16-24H2,1-2,4-6H3 |
| InChIKey | FNNKEPUPOGRHEM-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 91.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.86 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|