About 4-(difluoromethoxy)-1,2-benzothiazole
4-(difluoromethoxy)-1,2-benzothiazole (PubChem CID 76538253) has the molecular formula C8H5F2NOS
and a molecular weight of 201.20 g/mol. Its IUPAC name is 4-(difluoromethoxy)-1,2-benzothiazole.
Molecular Properties
| Compound Name | 4-(difluoromethoxy)-1,2-benzothiazole |
| PubChem CID | 76538253 |
| Molecular Formula | C8H5F2NOS |
| Molecular Weight | 201.20 g/mol |
| Exact Mass | 201.01 |
| IUPAC Name | 4-(difluoromethoxy)-1,2-benzothiazole |
| SMILES | FC(F)Oc1cccc2sncc12 |
| InChI | InChI=1S/C8H5F2NOS/c9-8(10)12-6-2-1-3-7-5(6)4-11-13-7/h1-4,8H |
| InChIKey | ZHBOZAOGPPBEIH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.20 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(difluoromethoxy)-1,2-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(difluoromethoxy)-1,2-benzothiazole?
The IUPAC name of 4-(difluoromethoxy)-1,2-benzothiazole (CID 76538253) is 4-(difluoromethoxy)-1,2-benzothiazole.
What is the SMILES notation for 4-(difluoromethoxy)-1,2-benzothiazole?
The canonical SMILES for 4-(difluoromethoxy)-1,2-benzothiazole is FC(F)Oc1cccc2sncc12.
What is the InChIKey of 4-(difluoromethoxy)-1,2-benzothiazole?
The InChIKey is ZHBOZAOGPPBEIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F2NOS/c9-8(10)12-6-2-1-3-7-5(6)4-11-13-7/h1-4,8H.
What are the key properties of 4-(difluoromethoxy)-1,2-benzothiazole?
4-(difluoromethoxy)-1,2-benzothiazole has a molecular weight of 201.20 g/mol, XLogP of 2.90, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(difluoromethoxy)-1,2-benzothiazole is sourced from PubChem (CID 76538253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).