About 3-(furan-3-yl)benzene-1,2-dicarbonitrile
3-(furan-3-yl)benzene-1,2-dicarbonitrile (PubChem CID 76539722) has the molecular formula C12H6N2O
and a molecular weight of 194.19 g/mol. Its IUPAC name is 3-(furan-3-yl)benzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 3-(furan-3-yl)benzene-1,2-dicarbonitrile |
| PubChem CID | 76539722 |
| Molecular Formula | C12H6N2O |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 3-(furan-3-yl)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1cccc(-c2ccoc2)c1C#N |
| InChI | InChI=1S/C12H6N2O/c13-6-9-2-1-3-11(12(9)7-14)10-4-5-15-8-10/h1-5,8H |
| InChIKey | NRQZKAIADIZLHZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 60.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(furan-3-yl)benzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(furan-3-yl)benzene-1,2-dicarbonitrile?
The IUPAC name of 3-(furan-3-yl)benzene-1,2-dicarbonitrile (CID 76539722) is 3-(furan-3-yl)benzene-1,2-dicarbonitrile.
What is the SMILES notation for 3-(furan-3-yl)benzene-1,2-dicarbonitrile?
The canonical SMILES for 3-(furan-3-yl)benzene-1,2-dicarbonitrile is N#Cc1cccc(-c2ccoc2)c1C#N.
What is the InChIKey of 3-(furan-3-yl)benzene-1,2-dicarbonitrile?
The InChIKey is NRQZKAIADIZLHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6N2O/c13-6-9-2-1-3-11(12(9)7-14)10-4-5-15-8-10/h1-5,8H.
What are the key properties of 3-(furan-3-yl)benzene-1,2-dicarbonitrile?
3-(furan-3-yl)benzene-1,2-dicarbonitrile has a molecular weight of 194.19 g/mol, XLogP of 2.69, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(furan-3-yl)benzene-1,2-dicarbonitrile is sourced from PubChem (CID 76539722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).