About 4-(1,3-thiazol-4-yl)benzene-1,2-dicarbonitrile
4-(1,3-thiazol-4-yl)benzene-1,2-dicarbonitrile (PubChem CID 76539824) has the molecular formula C11H5N3S
and a molecular weight of 211.25 g/mol. Its IUPAC name is 4-(1,3-thiazol-4-yl)benzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4-(1,3-thiazol-4-yl)benzene-1,2-dicarbonitrile |
| PubChem CID | 76539824 |
| Molecular Formula | C11H5N3S |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.02 |
| IUPAC Name | 4-(1,3-thiazol-4-yl)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(-c2cscn2)cc1C#N |
| InChI | InChI=1S/C11H5N3S/c12-4-9-2-1-8(3-10(9)5-13)11-6-15-7-14-11/h1-3,6-7H |
| InChIKey | JLSAQTPPVOXUJC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1,3-thiazol-4-yl)benzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-thiazol-4-yl)benzene-1,2-dicarbonitrile?
The IUPAC name of 4-(1,3-thiazol-4-yl)benzene-1,2-dicarbonitrile (CID 76539824) is 4-(1,3-thiazol-4-yl)benzene-1,2-dicarbonitrile.
What is the SMILES notation for 4-(1,3-thiazol-4-yl)benzene-1,2-dicarbonitrile?
The canonical SMILES for 4-(1,3-thiazol-4-yl)benzene-1,2-dicarbonitrile is N#Cc1ccc(-c2cscn2)cc1C#N.
What is the InChIKey of 4-(1,3-thiazol-4-yl)benzene-1,2-dicarbonitrile?
The InChIKey is JLSAQTPPVOXUJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5N3S/c12-4-9-2-1-8(3-10(9)5-13)11-6-15-7-14-11/h1-3,6-7H.
What are the key properties of 4-(1,3-thiazol-4-yl)benzene-1,2-dicarbonitrile?
4-(1,3-thiazol-4-yl)benzene-1,2-dicarbonitrile has a molecular weight of 211.25 g/mol, XLogP of 2.55, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-thiazol-4-yl)benzene-1,2-dicarbonitrile is sourced from PubChem (CID 76539824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).