About bis(4-hydroxybut-2-enyl) carbonate
bis(4-hydroxybut-2-enyl) carbonate (PubChem CID 76542076) has the molecular formula C9H14O5
and a molecular weight of 202.21 g/mol. Its IUPAC name is bis(4-hydroxybut-2-enyl) carbonate.
Molecular Properties
| Compound Name | bis(4-hydroxybut-2-enyl) carbonate |
| PubChem CID | 76542076 |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | bis(4-hydroxybut-2-enyl) carbonate |
| SMILES | O=C(OCC=CCO)OCC=CCO |
| InChI | InChI=1S/C9H14O5/c10-5-1-3-7-13-9(12)14-8-4-2-6-11/h1-4,10-11H,5-8H2 |
| InChIKey | DARDKBQVNKOSGN-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis(4-hydroxybut-2-enyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-hydroxybut-2-enyl) carbonate?
The IUPAC name of bis(4-hydroxybut-2-enyl) carbonate (CID 76542076) is bis(4-hydroxybut-2-enyl) carbonate.
What is the SMILES notation for bis(4-hydroxybut-2-enyl) carbonate?
The canonical SMILES for bis(4-hydroxybut-2-enyl) carbonate is O=C(OCC=CCO)OCC=CCO.
What is the InChIKey of bis(4-hydroxybut-2-enyl) carbonate?
The InChIKey is DARDKBQVNKOSGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O5/c10-5-1-3-7-13-9(12)14-8-4-2-6-11/h1-4,10-11H,5-8H2.
What are the key properties of bis(4-hydroxybut-2-enyl) carbonate?
bis(4-hydroxybut-2-enyl) carbonate has a molecular weight of 202.21 g/mol, XLogP of 0.24, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-hydroxybut-2-enyl) carbonate is sourced from PubChem (CID 76542076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).