About buta-1,3-dienylurea
buta-1,3-dienylurea (PubChem CID 76542948) has the molecular formula C5H8N2O
and a molecular weight of 112.13 g/mol. Its IUPAC name is buta-1,3-dienylurea.
Molecular Properties
| Compound Name | buta-1,3-dienylurea |
| PubChem CID | 76542948 |
| Molecular Formula | C5H8N2O |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.06 |
| IUPAC Name | buta-1,3-dienylurea |
| SMILES | C=CC=CNC(N)=O |
| InChI | InChI=1S/C5H8N2O/c1-2-3-4-7-5(6)8/h2-4H,1H2,(H3,6,7,8) |
| InChIKey | KAAIRXJVIHFTMO-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze buta-1,3-dienylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of buta-1,3-dienylurea?
The IUPAC name of buta-1,3-dienylurea (CID 76542948) is buta-1,3-dienylurea.
What is the SMILES notation for buta-1,3-dienylurea?
The canonical SMILES for buta-1,3-dienylurea is C=CC=CNC(N)=O.
What is the InChIKey of buta-1,3-dienylurea?
The InChIKey is KAAIRXJVIHFTMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O/c1-2-3-4-7-5(6)8/h2-4H,1H2,(H3,6,7,8).
What are the key properties of buta-1,3-dienylurea?
buta-1,3-dienylurea has a molecular weight of 112.13 g/mol, XLogP of 0.35, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for buta-1,3-dienylurea is sourced from PubChem (CID 76542948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).