About [2-(benzylamino)-2-oxoethyl] 3-phenylpropanoate
[2-(benzylamino)-2-oxoethyl] 3-phenylpropanoate (PubChem CID 7654679) has the molecular formula C18H19NO3
and a molecular weight of 297.35 g/mol. Its IUPAC name is [2-(benzylamino)-2-oxoethyl] 3-phenylpropanoate.
Molecular Properties
| Compound Name | [2-(benzylamino)-2-oxoethyl] 3-phenylpropanoate |
| PubChem CID | 7654679 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | [2-(benzylamino)-2-oxoethyl] 3-phenylpropanoate |
| SMILES | O=C(COC(=O)CCc1ccccc1)NCc1ccccc1 |
| InChI | InChI=1S/C18H19NO3/c20-17(19-13-16-9-5-2-6-10-16)14-22-18(21)12-11-15-7-3-1-4-8-15/h1-10H,11-14H2,(H,19,20) |
| InChIKey | LWHFZJYYAPAVKO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(benzylamino)-2-oxoethyl] 3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(benzylamino)-2-oxoethyl] 3-phenylpropanoate?
The IUPAC name of [2-(benzylamino)-2-oxoethyl] 3-phenylpropanoate (CID 7654679) is [2-(benzylamino)-2-oxoethyl] 3-phenylpropanoate.
What is the SMILES notation for [2-(benzylamino)-2-oxoethyl] 3-phenylpropanoate?
The canonical SMILES for [2-(benzylamino)-2-oxoethyl] 3-phenylpropanoate is O=C(COC(=O)CCc1ccccc1)NCc1ccccc1.
What is the InChIKey of [2-(benzylamino)-2-oxoethyl] 3-phenylpropanoate?
The InChIKey is LWHFZJYYAPAVKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO3/c20-17(19-13-16-9-5-2-6-10-16)14-22-18(21)12-11-15-7-3-1-4-8-15/h1-10H,11-14H2,(H,19,20).
What are the key properties of [2-(benzylamino)-2-oxoethyl] 3-phenylpropanoate?
[2-(benzylamino)-2-oxoethyl] 3-phenylpropanoate has a molecular weight of 297.35 g/mol, XLogP of 2.48, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(benzylamino)-2-oxoethyl] 3-phenylpropanoate is sourced from PubChem (CID 7654679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).