C16H17N3 — CID 765471
2,4,7,9-tetramethylbenzo[b][1,8]naphthyridin-5-amine (PubChem CID 765471) has the molecular formula C16H17N3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 2,4,7,9-tetramethylbenzo[b][1,8]naphthyridin-5-amine.
| Compound Name | 2,4,7,9-tetramethylbenzo[b][1,8]naphthyridin-5-amine |
|---|---|
| PubChem CID | 765471 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 2,4,7,9-tetramethylbenzo[b][1,8]naphthyridin-5-amine |
| SMILES | Cc1cc(C)c2nc3nc(C)cc(C)c3c(N)c2c1 |
| InChI | InChI=1S/C16H17N3/c1-8-5-10(3)15-12(6-8)14(17)13-9(2)7-11(4)18-16(13)19-15/h5-7H,1-4H3,(H2,17,18,19) |
| InChIKey | ZNPSDSMZKLWRLO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|