About N'-(1,1-dioxo-1,2-benzothiazol-3-yl)benzohydrazide
N'-(1,1-dioxo-1,2-benzothiazol-3-yl)benzohydrazide (PubChem CID 765489) has the molecular formula C14H11N3O3S
and a molecular weight of 301.33 g/mol. Its IUPAC name is N'-(1,1-dioxo-1,2-benzothiazol-3-yl)benzohydrazide.
Molecular Properties
| Compound Name | N'-(1,1-dioxo-1,2-benzothiazol-3-yl)benzohydrazide |
| PubChem CID | 765489 |
| Molecular Formula | C14H11N3O3S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | N'-(1,1-dioxo-1,2-benzothiazol-3-yl)benzohydrazide |
| SMILES | O=C(NNC1=NS(=O)(=O)c2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C14H11N3O3S/c18-14(10-6-2-1-3-7-10)16-15-13-11-8-4-5-9-12(11)21(19,20)17-13/h1-9H,(H,15,17)(H,16,18) |
| InChIKey | IOPZVJITKGRQLJ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(1,1-dioxo-1,2-benzothiazol-3-yl)benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(1,1-dioxo-1,2-benzothiazol-3-yl)benzohydrazide?
The IUPAC name of N'-(1,1-dioxo-1,2-benzothiazol-3-yl)benzohydrazide (CID 765489) is N'-(1,1-dioxo-1,2-benzothiazol-3-yl)benzohydrazide.
What is the SMILES notation for N'-(1,1-dioxo-1,2-benzothiazol-3-yl)benzohydrazide?
The canonical SMILES for N'-(1,1-dioxo-1,2-benzothiazol-3-yl)benzohydrazide is O=C(NNC1=NS(=O)(=O)c2ccccc21)c1ccccc1.
What is the InChIKey of N'-(1,1-dioxo-1,2-benzothiazol-3-yl)benzohydrazide?
The InChIKey is IOPZVJITKGRQLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3O3S/c18-14(10-6-2-1-3-7-10)16-15-13-11-8-4-5-9-12(11)21(19,20)17-13/h1-9H,(H,15,17)(H,16,18).
What are the key properties of N'-(1,1-dioxo-1,2-benzothiazol-3-yl)benzohydrazide?
N'-(1,1-dioxo-1,2-benzothiazol-3-yl)benzohydrazide has a molecular weight of 301.33 g/mol, XLogP of 1.07, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1,1-dioxo-1,2-benzothiazol-3-yl)benzohydrazide is sourced from PubChem (CID 765489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).