About CID 76549260
CID 76549260 (PubChem CID 76549260) has the molecular formula C5H9O
and a molecular weight of 85.13 g/mol.
Molecular Properties
| Compound Name | CID 76549260 |
| PubChem CID | 76549260 |
| Molecular Formula | C5H9O |
| Molecular Weight | 85.13 g/mol |
| Exact Mass | 85.07 |
| IUPAC Name | — |
| SMILES | C=C[C](C)CO |
| InChI | InChI=1S/C5H9O/c1-3-5(2)4-6/h3,6H,1,4H2,2H3 |
| InChIKey | CLGHLEUXPPGIBO-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 85.13 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 76549260 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 76549260?
The IUPAC name of CID 76549260 (CID 76549260) is not available.
What is the SMILES notation for CID 76549260?
The canonical SMILES for CID 76549260 is C=C[C](C)CO.
What is the InChIKey of CID 76549260?
The InChIKey is CLGHLEUXPPGIBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9O/c1-3-5(2)4-6/h3,6H,1,4H2,2H3.
What are the key properties of CID 76549260?
CID 76549260 has a molecular weight of 85.13 g/mol, XLogP of 0.76, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 76549260 is sourced from PubChem (CID 76549260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).