About 1-(2-oxopyrrolidin-1-yl)buta-1,3-dienyl acetate
1-(2-oxopyrrolidin-1-yl)buta-1,3-dienyl acetate (PubChem CID 76549337) has the molecular formula C10H13NO3
and a molecular weight of 195.22 g/mol. Its IUPAC name is 1-(2-oxopyrrolidin-1-yl)buta-1,3-dienyl acetate.
Molecular Properties
| Compound Name | 1-(2-oxopyrrolidin-1-yl)buta-1,3-dienyl acetate |
| PubChem CID | 76549337 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 1-(2-oxopyrrolidin-1-yl)buta-1,3-dienyl acetate |
| SMILES | C=CC=C(OC(C)=O)N1CCCC1=O |
| InChI | InChI=1S/C10H13NO3/c1-3-5-10(14-8(2)12)11-7-4-6-9(11)13/h3,5H,1,4,6-7H2,2H3 |
| InChIKey | HZAYAASZTURCQQ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-oxopyrrolidin-1-yl)buta-1,3-dienyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-oxopyrrolidin-1-yl)buta-1,3-dienyl acetate?
The IUPAC name of 1-(2-oxopyrrolidin-1-yl)buta-1,3-dienyl acetate (CID 76549337) is 1-(2-oxopyrrolidin-1-yl)buta-1,3-dienyl acetate.
What is the SMILES notation for 1-(2-oxopyrrolidin-1-yl)buta-1,3-dienyl acetate?
The canonical SMILES for 1-(2-oxopyrrolidin-1-yl)buta-1,3-dienyl acetate is C=CC=C(OC(C)=O)N1CCCC1=O.
What is the InChIKey of 1-(2-oxopyrrolidin-1-yl)buta-1,3-dienyl acetate?
The InChIKey is HZAYAASZTURCQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3/c1-3-5-10(14-8(2)12)11-7-4-6-9(11)13/h3,5H,1,4,6-7H2,2H3.
What are the key properties of 1-(2-oxopyrrolidin-1-yl)buta-1,3-dienyl acetate?
1-(2-oxopyrrolidin-1-yl)buta-1,3-dienyl acetate has a molecular weight of 195.22 g/mol, XLogP of 1.20, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-oxopyrrolidin-1-yl)buta-1,3-dienyl acetate is sourced from PubChem (CID 76549337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).