C39H38ClN7O4Si — CID 76550508
3-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-N-(5-chloro-2-pyridinyl)-2-[1-(3-cyano-2-methylphenyl)pyrazolo[5,4-d]pyrimidin-4-yl]oxypropanamide (PubChem CID 76550508) has the molecular formula C39H38ClN7O4Si and a molecular weight of 732.32 g/mol. Its IUPAC name is 3-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-N-(5-chloro-2-pyridinyl)-2-[1-(3-cyano-2-methylphenyl)pyrazolo[5,4-d]pyrimidin-4-yl]oxypropanamide.
| Compound Name | 3-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-N-(5-chloro-2-pyridinyl)-2-[1-(3-cyano-2-methylphenyl)pyrazolo[5,4-d]pyrimidin-4-yl]oxypropanamide |
|---|---|
| PubChem CID | 76550508 |
| Molecular Formula | C39H38ClN7O4Si |
| Molecular Weight | 732.32 g/mol |
| Exact Mass | 731.24 |
| IUPAC Name | 3-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-N-(5-chloro-2-pyridinyl)-2-[1-(3-cyano-2-methylphenyl)pyrazolo[5,4-d]pyrimidin-4-yl]oxypropanamide |
| SMILES | Cc1c(C#N)cccc1-n1ncc2c(OC(COCCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C(=O)Nc3ccc(Cl)cn3)ncnc21 |
| InChI | InChI=1S/C39H38ClN7O4Si/c1-27-28(22-41)12-11-17-33(27)47-36-32(24-45-47)38(44-26-43-36)51-34(37(48)46-35-19-18-29(40)23-42-35)25-49-20-21-50-52(39(2,3)4,30-13-7-5-8-14-30)31-15-9-6-10-16-31/h5-19,23-24,26,34H,20-21,25H2,1-4H3,(H,42,46,48) |
| InChIKey | VBQNPVZQULHHOC-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.32 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|