C24H23F3N4O4 — CID 76550690
5-[3-[3-(2,3-dihydroxypropyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]-1,2,4-oxadiazol-5-yl]-2-(2,2,2-trifluoroethoxy)benzonitrile (PubChem CID 76550690) has the molecular formula C24H23F3N4O4 and a molecular weight of 488.47 g/mol. Its IUPAC name is 5-[3-[3-(2,3-dihydroxypropyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]-1,2,4-oxadiazol-5-yl]-2-(2,2,2-trifluoroethoxy)benzonitrile.
| Compound Name | 5-[3-[3-(2,3-dihydroxypropyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]-1,2,4-oxadiazol-5-yl]-2-(2,2,2-trifluoroethoxy)benzonitrile |
|---|---|
| PubChem CID | 76550690 |
| Molecular Formula | C24H23F3N4O4 |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | 5-[3-[3-(2,3-dihydroxypropyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]-1,2,4-oxadiazol-5-yl]-2-(2,2,2-trifluoroethoxy)benzonitrile |
| SMILES | N#Cc1cc(-c2nc(-c3ccc4c(c3)CCN(CC(O)CO)CC4)no2)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C24H23F3N4O4/c25-24(26,27)14-34-21-4-3-18(10-19(21)11-28)23-29-22(30-35-23)17-2-1-15-5-7-31(12-20(33)13-32)8-6-16(15)9-17/h1-4,9-10,20,32-33H,5-8,12-14H2 |
| InChIKey | XUBGJBWGMXLMHN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |