C21H18N2O3S2 — CID 76552640
4-[(2,5-dimethylphenyl)methyl]-6-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1,4-benzoxazin-3-one (PubChem CID 76552640) has the molecular formula C21H18N2O3S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 4-[(2,5-dimethylphenyl)methyl]-6-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1,4-benzoxazin-3-one.
| Compound Name | 4-[(2,5-dimethylphenyl)methyl]-6-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 76552640 |
| Molecular Formula | C21H18N2O3S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 4-[(2,5-dimethylphenyl)methyl]-6-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1,4-benzoxazin-3-one |
| SMILES | Cc1ccc(C)c(CN2C(=O)COc3ccc(C=C4SC(=S)NC4=O)cc32)c1 |
| InChI | InChI=1S/C21H18N2O3S2/c1-12-3-4-13(2)15(7-12)10-23-16-8-14(5-6-17(16)26-11-19(23)24)9-18-20(25)22-21(27)28-18/h3-9H,10-11H2,1-2H3,(H,22,25,27) |
| InChIKey | VPNRUADUZPBXCG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|