C19H14N2O5S3 — CID 76552702
3-[(4-methylsulfonylphenyl)methyl]-5-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1,3-benzoxazol-2-one (PubChem CID 76552702) has the molecular formula C19H14N2O5S3 and a molecular weight of 446.53 g/mol. Its IUPAC name is 3-[(4-methylsulfonylphenyl)methyl]-5-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1,3-benzoxazol-2-one.
| Compound Name | 3-[(4-methylsulfonylphenyl)methyl]-5-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 76552702 |
| Molecular Formula | C19H14N2O5S3 |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.01 |
| IUPAC Name | 3-[(4-methylsulfonylphenyl)methyl]-5-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1,3-benzoxazol-2-one |
| SMILES | CS(=O)(=O)c1ccc(Cn2c(=O)oc3ccc(C=C4SC(=S)NC4=O)cc32)cc1 |
| InChI | InChI=1S/C19H14N2O5S3/c1-29(24,25)13-5-2-11(3-6-13)10-21-14-8-12(4-7-15(14)26-19(21)23)9-16-17(22)20-18(27)28-16/h2-9H,10H2,1H3,(H,20,22,27) |
| InChIKey | WVHJAEQGWUCUGU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 98.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|